N-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methylthiophen-3-yl]-2-methoxyacetamide
Chemical Structure Depiction of
N-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methylthiophen-3-yl]-2-methoxyacetamide
N-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methylthiophen-3-yl]-2-methoxyacetamide
Compound characteristics
| Compound ID: | M410-0325 |
| Compound Name: | N-[5-(5-ethyl-1,3,4-oxadiazol-2-yl)-2-methylthiophen-3-yl]-2-methoxyacetamide |
| Molecular Weight: | 281.33 |
| Molecular Formula: | C12 H15 N3 O3 S |
| Smiles: | CCc1nnc(c2cc(c(C)s2)NC(COC)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 1.5367 |
| logD: | 1.5367 |
| logSw: | -2.343 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.313 |
| InChI Key: | UABCNOBUPOZITO-UHFFFAOYSA-N |