2-ethyl-5-{5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl}-1,3-benzoxazole
Chemical Structure Depiction of
2-ethyl-5-{5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl}-1,3-benzoxazole
2-ethyl-5-{5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl}-1,3-benzoxazole
Compound characteristics
| Compound ID: | M416-0500 |
| Compound Name: | 2-ethyl-5-{5-[(3-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl}-1,3-benzoxazole |
| Molecular Weight: | 323.32 |
| Molecular Formula: | C18 H14 F N3 O2 |
| Smiles: | CCc1nc2cc(ccc2o1)c1nc(Cc2cccc(c2)F)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.983 |
| logD: | 4.983 |
| logSw: | -4.7746 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.057 |
| InChI Key: | JJKKWDHZUMNYDU-UHFFFAOYSA-N |