3-methyl-2-(6-{[(3-methylphenyl)methyl]sulfanyl}pyridazin-3-yl)-2,4,5,6-tetrahydrocyclopenta[c]pyrazole
Chemical Structure Depiction of
3-methyl-2-(6-{[(3-methylphenyl)methyl]sulfanyl}pyridazin-3-yl)-2,4,5,6-tetrahydrocyclopenta[c]pyrazole
3-methyl-2-(6-{[(3-methylphenyl)methyl]sulfanyl}pyridazin-3-yl)-2,4,5,6-tetrahydrocyclopenta[c]pyrazole
Compound characteristics
| Compound ID: | M428-1653 |
| Compound Name: | 3-methyl-2-(6-{[(3-methylphenyl)methyl]sulfanyl}pyridazin-3-yl)-2,4,5,6-tetrahydrocyclopenta[c]pyrazole |
| Molecular Weight: | 336.46 |
| Molecular Formula: | C19 H20 N4 S |
| Smiles: | Cc1cccc(CSc2ccc(nn2)n2c(C)c3CCCc3n2)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.3343 |
| logD: | 4.3333 |
| logSw: | -4.4333 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.163 |
| InChI Key: | RXCADYINRFTONG-UHFFFAOYSA-N |