2-(6-{[(4-fluorophenyl)methyl]sulfanyl}pyridazin-3-yl)-3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazole
Chemical Structure Depiction of
2-(6-{[(4-fluorophenyl)methyl]sulfanyl}pyridazin-3-yl)-3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazole
2-(6-{[(4-fluorophenyl)methyl]sulfanyl}pyridazin-3-yl)-3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazole
Compound characteristics
| Compound ID: | M428-1658 |
| Compound Name: | 2-(6-{[(4-fluorophenyl)methyl]sulfanyl}pyridazin-3-yl)-3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazole |
| Molecular Weight: | 340.42 |
| Molecular Formula: | C18 H17 F N4 S |
| Smiles: | Cc1c2CCCc2nn1c1ccc(nn1)SCc1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 3.4392 |
| logD: | 3.4383 |
| logSw: | -3.6149 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.163 |
| InChI Key: | PNSWWRRDUDKKPV-UHFFFAOYSA-N |