2-(6-{[(4-chlorophenyl)methyl]sulfanyl}pyridazin-3-yl)-3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazole
Chemical Structure Depiction of
2-(6-{[(4-chlorophenyl)methyl]sulfanyl}pyridazin-3-yl)-3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazole
2-(6-{[(4-chlorophenyl)methyl]sulfanyl}pyridazin-3-yl)-3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazole
Compound characteristics
| Compound ID: | M428-1662 |
| Compound Name: | 2-(6-{[(4-chlorophenyl)methyl]sulfanyl}pyridazin-3-yl)-3-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazole |
| Molecular Weight: | 356.87 |
| Molecular Formula: | C18 H17 Cl N4 S |
| Smiles: | Cc1c2CCCc2nn1c1ccc(nn1)SCc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.0049 |
| logD: | 4.0039 |
| logSw: | -4.39 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.163 |
| InChI Key: | BZDKDNUAGULJCD-UHFFFAOYSA-N |