3-{[(3-fluorophenyl)methyl]sulfanyl}-6-[5-(4-methoxyphenyl)-1H-pyrazol-1-yl]pyridazine
Chemical Structure Depiction of
3-{[(3-fluorophenyl)methyl]sulfanyl}-6-[5-(4-methoxyphenyl)-1H-pyrazol-1-yl]pyridazine
3-{[(3-fluorophenyl)methyl]sulfanyl}-6-[5-(4-methoxyphenyl)-1H-pyrazol-1-yl]pyridazine
Compound characteristics
| Compound ID: | M428-1747 |
| Compound Name: | 3-{[(3-fluorophenyl)methyl]sulfanyl}-6-[5-(4-methoxyphenyl)-1H-pyrazol-1-yl]pyridazine |
| Molecular Weight: | 392.45 |
| Molecular Formula: | C21 H17 F N4 O S |
| Smiles: | COc1ccc(cc1)c1ccnn1c1ccc(nn1)SCc1cccc(c1)F |
| Stereo: | ACHIRAL |
| logP: | 4.8771 |
| logD: | 4.8771 |
| logSw: | -4.7301 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.035 |
| InChI Key: | AOSUMWAXOUMIFL-UHFFFAOYSA-N |