N-(4-fluorophenyl)-4-hydroxy-2-oxo-1,5,6,7,8,9-hexahydro-2H-cyclohepta[4,5]thieno[2,3-b]pyridine-3-carboxamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-4-hydroxy-2-oxo-1,5,6,7,8,9-hexahydro-2H-cyclohepta[4,5]thieno[2,3-b]pyridine-3-carboxamide
N-(4-fluorophenyl)-4-hydroxy-2-oxo-1,5,6,7,8,9-hexahydro-2H-cyclohepta[4,5]thieno[2,3-b]pyridine-3-carboxamide
Compound characteristics
| Compound ID: | M435-1924 |
| Compound Name: | N-(4-fluorophenyl)-4-hydroxy-2-oxo-1,5,6,7,8,9-hexahydro-2H-cyclohepta[4,5]thieno[2,3-b]pyridine-3-carboxamide |
| Molecular Weight: | 372.42 |
| Molecular Formula: | C19 H17 F N2 O3 S |
| Smiles: | C1CCc2c3C(=C(C(Nc4ccc(cc4)F)=O)C(Nc3sc2CC1)=O)O |
| Stereo: | ACHIRAL |
| logP: | 3.4767 |
| logD: | -0.2045 |
| logSw: | -3.9014 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 63.432 |
| InChI Key: | ZCILCJXTDMBDII-UHFFFAOYSA-N |