N-{3-[ethyl(phenyl)amino]propyl}-3-[6-(4-methylphenyl)[1,2,4]triazolo[4,3-b]pyridazin-3-yl]propanamide
Chemical Structure Depiction of
N-{3-[ethyl(phenyl)amino]propyl}-3-[6-(4-methylphenyl)[1,2,4]triazolo[4,3-b]pyridazin-3-yl]propanamide
N-{3-[ethyl(phenyl)amino]propyl}-3-[6-(4-methylphenyl)[1,2,4]triazolo[4,3-b]pyridazin-3-yl]propanamide
Compound characteristics
| Compound ID: | M454-0730 |
| Compound Name: | N-{3-[ethyl(phenyl)amino]propyl}-3-[6-(4-methylphenyl)[1,2,4]triazolo[4,3-b]pyridazin-3-yl]propanamide |
| Molecular Weight: | 442.56 |
| Molecular Formula: | C26 H30 N6 O |
| Smiles: | CCN(CCCNC(CCc1nnc2ccc(c3ccc(C)cc3)nn12)=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.5644 |
| logD: | 3.5352 |
| logSw: | -3.4641 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.404 |
| InChI Key: | JVICLGOAATYFBK-UHFFFAOYSA-N |