2-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-6-(3-methoxyphenyl)pyridazin-3(2H)-one
Chemical Structure Depiction of
2-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-6-(3-methoxyphenyl)pyridazin-3(2H)-one
2-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-6-(3-methoxyphenyl)pyridazin-3(2H)-one
Compound characteristics
| Compound ID: | M455-0554 |
| Compound Name: | 2-{2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl}-6-(3-methoxyphenyl)pyridazin-3(2H)-one |
| Molecular Weight: | 408.84 |
| Molecular Formula: | C21 H17 Cl N4 O3 |
| Smiles: | COc1cccc(c1)C1C=CC(N(CCc2nc(c3ccc(cc3)[Cl])no2)N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7507 |
| logD: | 4.7507 |
| logSw: | -4.9593 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 67.413 |
| InChI Key: | YILRKBSUOBNEIE-UHFFFAOYSA-N |