N-(4-chloro-2-fluorophenyl)-2-{[4-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl}acetamide
					Chemical Structure Depiction of
N-(4-chloro-2-fluorophenyl)-2-{[4-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl}acetamide
			N-(4-chloro-2-fluorophenyl)-2-{[4-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | M459-0902 | 
| Compound Name: | N-(4-chloro-2-fluorophenyl)-2-{[4-(4-phenylpiperazin-1-yl)pyrimidin-2-yl]sulfanyl}acetamide | 
| Molecular Weight: | 457.96 | 
| Molecular Formula: | C22 H21 Cl F N5 O S | 
| Smiles: | C1CN(CCN1c1ccccc1)c1ccnc(n1)SCC(Nc1ccc(cc1F)[Cl])=O | 
| Stereo: | ACHIRAL | 
| logP: | 5.0763 | 
| logD: | 5.0685 | 
| logSw: | -5.3186 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 46.32 | 
| InChI Key: | GSHYQBCWAAGHOI-UHFFFAOYSA-N | 
 
				 
				