N-[(4-methoxyphenyl)methyl]-2-({4-[4-(3-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-[(4-methoxyphenyl)methyl]-2-({4-[4-(3-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide
N-[(4-methoxyphenyl)methyl]-2-({4-[4-(3-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | M459-2748 |
| Compound Name: | N-[(4-methoxyphenyl)methyl]-2-({4-[4-(3-methoxyphenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide |
| Molecular Weight: | 479.6 |
| Molecular Formula: | C25 H29 N5 O3 S |
| Smiles: | COc1ccc(CNC(CSc2nccc(n2)N2CCN(CC2)c2cccc(c2)OC)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.2262 |
| logD: | 4.2261 |
| logSw: | -4.3002 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.428 |
| InChI Key: | OYGBRYHCKSDLGY-UHFFFAOYSA-N |