N-(3,4-dimethoxyphenyl)-2-({4-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide
					Chemical Structure Depiction of
N-(3,4-dimethoxyphenyl)-2-({4-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide
			N-(3,4-dimethoxyphenyl)-2-({4-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | M459-2946 | 
| Compound Name: | N-(3,4-dimethoxyphenyl)-2-({4-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide | 
| Molecular Weight: | 483.56 | 
| Molecular Formula: | C24 H26 F N5 O3 S | 
| Smiles: | COc1ccc(cc1OC)NC(CSc1nccc(n1)N1CCN(CC1)c1ccc(cc1)F)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.14 | 
| logD: | 4.14 | 
| logSw: | -4.2432 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 62.279 | 
| InChI Key: | WHXGMBSWURPEJC-UHFFFAOYSA-N | 
 
				 
				