N-(3-chloro-4-fluorophenyl)-2-({4-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-2-({4-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide
N-(3-chloro-4-fluorophenyl)-2-({4-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide
Compound characteristics
| Compound ID: | M459-3006 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-2-({4-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-2-yl}sulfanyl)acetamide |
| Molecular Weight: | 475.95 |
| Molecular Formula: | C22 H20 Cl F2 N5 O S |
| Smiles: | C1CN(CCN1c1ccc(cc1)F)c1ccnc(n1)SCC(Nc1ccc(c(c1)[Cl])F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3352 |
| logD: | 5.3276 |
| logSw: | -5.9514 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.018 |
| InChI Key: | CVZBLKAALFGAKR-UHFFFAOYSA-N |