3-[4-(4-chlorophenyl)piperazine-1-sulfonyl]-1-methyl-N-(3-methylphenyl)-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
3-[4-(4-chlorophenyl)piperazine-1-sulfonyl]-1-methyl-N-(3-methylphenyl)-1H-pyrazole-4-carboxamide
3-[4-(4-chlorophenyl)piperazine-1-sulfonyl]-1-methyl-N-(3-methylphenyl)-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | M461-2985 |
| Compound Name: | 3-[4-(4-chlorophenyl)piperazine-1-sulfonyl]-1-methyl-N-(3-methylphenyl)-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 473.98 |
| Molecular Formula: | C22 H24 Cl N5 O3 S |
| Smiles: | Cc1cccc(c1)NC(c1cn(C)nc1S(N1CCN(CC1)c1ccc(cc1)[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4384 |
| logD: | 3.438 |
| logSw: | -3.87 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.431 |
| InChI Key: | XGENXBDJWYBRNP-UHFFFAOYSA-N |