3-[4-(4-chlorophenyl)piperazine-1-sulfonyl]-N-(3-fluorophenyl)-1-methyl-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
3-[4-(4-chlorophenyl)piperazine-1-sulfonyl]-N-(3-fluorophenyl)-1-methyl-1H-pyrazole-4-carboxamide
3-[4-(4-chlorophenyl)piperazine-1-sulfonyl]-N-(3-fluorophenyl)-1-methyl-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | M461-2998 |
| Compound Name: | 3-[4-(4-chlorophenyl)piperazine-1-sulfonyl]-N-(3-fluorophenyl)-1-methyl-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 477.94 |
| Molecular Formula: | C21 H21 Cl F N5 O3 S |
| Smiles: | Cn1cc(C(Nc2cccc(c2)F)=O)c(n1)S(N1CCN(CC1)c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2318 |
| logD: | 3.1855 |
| logSw: | -3.7819 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.431 |
| InChI Key: | IGPZPBKZSTWMRU-UHFFFAOYSA-N |