3-[4-(2-ethoxyphenyl)piperazine-1-sulfonyl]-1-methyl-N-[(oxolan-2-yl)methyl]-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
3-[4-(2-ethoxyphenyl)piperazine-1-sulfonyl]-1-methyl-N-[(oxolan-2-yl)methyl]-1H-pyrazole-4-carboxamide
3-[4-(2-ethoxyphenyl)piperazine-1-sulfonyl]-1-methyl-N-[(oxolan-2-yl)methyl]-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | M461-5416 |
| Compound Name: | 3-[4-(2-ethoxyphenyl)piperazine-1-sulfonyl]-1-methyl-N-[(oxolan-2-yl)methyl]-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 477.58 |
| Molecular Formula: | C22 H31 N5 O5 S |
| Smiles: | CCOc1ccccc1N1CCN(CC1)S(c1c(cn(C)n1)C(NCC1CCCO1)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.3404 |
| logD: | 1.3404 |
| logSw: | -2.4654 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 90.317 |
| InChI Key: | SSFMPIMNOYMCGJ-QGZVFWFLSA-N |