3-(azepane-1-sulfonyl)-N-(2-fluoro-4-methylphenyl)-1-methyl-1H-pyrazole-4-carboxamide
					Chemical Structure Depiction of
3-(azepane-1-sulfonyl)-N-(2-fluoro-4-methylphenyl)-1-methyl-1H-pyrazole-4-carboxamide
			3-(azepane-1-sulfonyl)-N-(2-fluoro-4-methylphenyl)-1-methyl-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | M461-8132 | 
| Compound Name: | 3-(azepane-1-sulfonyl)-N-(2-fluoro-4-methylphenyl)-1-methyl-1H-pyrazole-4-carboxamide | 
| Molecular Weight: | 394.47 | 
| Molecular Formula: | C18 H23 F N4 O3 S | 
| Smiles: | Cc1ccc(c(c1)F)NC(c1cn(C)nc1S(N1CCCCCC1)(=O)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 2.6773 | 
| logD: | 2.6163 | 
| logSw: | -3.2551 | 
| Hydrogen bond acceptors count: | 8 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 69.804 | 
| InChI Key: | BGIGRXLVLHVIFN-UHFFFAOYSA-N | 
 
				 
				