3-methyl-N-[3-(thiophen-2-yl)-1,2-oxazol-5-yl]benzamide
Chemical Structure Depiction of
3-methyl-N-[3-(thiophen-2-yl)-1,2-oxazol-5-yl]benzamide
3-methyl-N-[3-(thiophen-2-yl)-1,2-oxazol-5-yl]benzamide
Compound characteristics
| Compound ID: | M466-0701 |
| Compound Name: | 3-methyl-N-[3-(thiophen-2-yl)-1,2-oxazol-5-yl]benzamide |
| Molecular Weight: | 284.33 |
| Molecular Formula: | C15 H12 N2 O2 S |
| Smiles: | Cc1cccc(c1)C(Nc1cc(c2cccs2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7804 |
| logD: | 3.752 |
| logSw: | -3.8825 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.629 |
| InChI Key: | LKJINEXWSWYBCW-UHFFFAOYSA-N |