6-chloro-N-[3-(thiophen-3-yl)-1,2-oxazol-5-yl]pyridine-3-carboxamide
Chemical Structure Depiction of
6-chloro-N-[3-(thiophen-3-yl)-1,2-oxazol-5-yl]pyridine-3-carboxamide
6-chloro-N-[3-(thiophen-3-yl)-1,2-oxazol-5-yl]pyridine-3-carboxamide
Compound characteristics
| Compound ID: | M466-1198 |
| Compound Name: | 6-chloro-N-[3-(thiophen-3-yl)-1,2-oxazol-5-yl]pyridine-3-carboxamide |
| Molecular Weight: | 305.74 |
| Molecular Formula: | C13 H8 Cl N3 O2 S |
| Smiles: | c1cc(ncc1C(Nc1cc(c2ccsc2)no1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.8953 |
| logD: | 2.7998 |
| logSw: | -3.6531 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.633 |
| InChI Key: | JBUDFCGPULXKHM-UHFFFAOYSA-N |