N-[3-(5-methylthiophen-2-yl)-1,2-oxazol-5-yl]cyclopropanecarboxamide
Chemical Structure Depiction of
N-[3-(5-methylthiophen-2-yl)-1,2-oxazol-5-yl]cyclopropanecarboxamide
N-[3-(5-methylthiophen-2-yl)-1,2-oxazol-5-yl]cyclopropanecarboxamide
Compound characteristics
| Compound ID: | M466-1321 |
| Compound Name: | N-[3-(5-methylthiophen-2-yl)-1,2-oxazol-5-yl]cyclopropanecarboxamide |
| Molecular Weight: | 248.3 |
| Molecular Formula: | C12 H12 N2 O2 S |
| Smiles: | Cc1ccc(c2cc(NC(C3CC3)=O)on2)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.2873 |
| logD: | 3.2871 |
| logSw: | -3.4565 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.152 |
| InChI Key: | DZMNKMWMLPHRBN-UHFFFAOYSA-N |