5-chloro-N-[3-(furan-2-yl)-1,2-oxazol-5-yl]-2-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
5-chloro-N-[3-(furan-2-yl)-1,2-oxazol-5-yl]-2-methoxybenzene-1-sulfonamide
5-chloro-N-[3-(furan-2-yl)-1,2-oxazol-5-yl]-2-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | M467-0231 |
| Compound Name: | 5-chloro-N-[3-(furan-2-yl)-1,2-oxazol-5-yl]-2-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 354.77 |
| Molecular Formula: | C14 H11 Cl N2 O5 S |
| Smiles: | COc1ccc(cc1S(Nc1cc(c2ccco2)no1)(=O)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.7404 |
| logD: | 2.0969 |
| logSw: | -3.5246 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.378 |
| InChI Key: | WXNULRDSCHGKCY-UHFFFAOYSA-N |