2,5-dimethoxy-N-[3-(thiophen-3-yl)-1,2-oxazol-5-yl]benzene-1-sulfonamide
Chemical Structure Depiction of
2,5-dimethoxy-N-[3-(thiophen-3-yl)-1,2-oxazol-5-yl]benzene-1-sulfonamide
2,5-dimethoxy-N-[3-(thiophen-3-yl)-1,2-oxazol-5-yl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | M467-0279 |
| Compound Name: | 2,5-dimethoxy-N-[3-(thiophen-3-yl)-1,2-oxazol-5-yl]benzene-1-sulfonamide |
| Molecular Weight: | 366.41 |
| Molecular Formula: | C15 H14 N2 O5 S2 |
| Smiles: | COc1ccc(c(c1)S(Nc1cc(c2ccsc2)no1)(=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.9083 |
| logD: | 2.6023 |
| logSw: | -3.5382 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.362 |
| InChI Key: | ZORLMIKHKYVAMC-UHFFFAOYSA-N |