2-[3-(3-chlorophenyl)-3-hydroxy-2-oxo-2,3-dihydro-1H-indol-1-yl]-N-(2-ethylphenyl)acetamide
Chemical Structure Depiction of
2-[3-(3-chlorophenyl)-3-hydroxy-2-oxo-2,3-dihydro-1H-indol-1-yl]-N-(2-ethylphenyl)acetamide
2-[3-(3-chlorophenyl)-3-hydroxy-2-oxo-2,3-dihydro-1H-indol-1-yl]-N-(2-ethylphenyl)acetamide
Compound characteristics
| Compound ID: | M506-0472 |
| Compound Name: | 2-[3-(3-chlorophenyl)-3-hydroxy-2-oxo-2,3-dihydro-1H-indol-1-yl]-N-(2-ethylphenyl)acetamide |
| Molecular Weight: | 420.89 |
| Molecular Formula: | C24 H21 Cl N2 O3 |
| Smiles: | CCc1ccccc1NC(CN1C(C(c2cccc(c2)[Cl])(c2ccccc12)O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6119 |
| logD: | 4.6119 |
| logSw: | -4.4559 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.78 |
| InChI Key: | DYTGFPNTYQMYLQ-DEOSSOPVSA-N |