N-(3,4-dimethylphenyl)-5-(4-ethyl-1,3-thiazol-2-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-5-(4-ethyl-1,3-thiazol-2-yl)thiophene-2-sulfonamide
N-(3,4-dimethylphenyl)-5-(4-ethyl-1,3-thiazol-2-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | M544-0527 |
| Compound Name: | N-(3,4-dimethylphenyl)-5-(4-ethyl-1,3-thiazol-2-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 378.53 |
| Molecular Formula: | C17 H18 N2 O2 S3 |
| Smiles: | CCc1csc(c2ccc(s2)S(Nc2ccc(C)c(C)c2)(=O)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.8025 |
| logD: | 5.8008 |
| logSw: | -5.5012 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.136 |
| InChI Key: | XRPWFQLKPRBASV-UHFFFAOYSA-N |