[4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl](2-methylphenyl)methanone
Chemical Structure Depiction of
[4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl](2-methylphenyl)methanone
[4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl](2-methylphenyl)methanone
Compound characteristics
| Compound ID: | M564-0175 |
| Compound Name: | [4-(5-amino-1,2-oxazol-3-yl)piperidin-1-yl](2-methylphenyl)methanone |
| Molecular Weight: | 285.34 |
| Molecular Formula: | C16 H19 N3 O2 |
| Smiles: | Cc1ccccc1C(N1CCC(CC1)c1cc(N)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9261 |
| logD: | 1.9261 |
| logSw: | -2.5363 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.928 |
| InChI Key: | JWQCZSKNNCXOPN-UHFFFAOYSA-N |