2-fluoro-N-{[2-(3-methylphenyl)pyridin-3-yl]methyl}benzamide
Chemical Structure Depiction of
2-fluoro-N-{[2-(3-methylphenyl)pyridin-3-yl]methyl}benzamide
2-fluoro-N-{[2-(3-methylphenyl)pyridin-3-yl]methyl}benzamide
Compound characteristics
| Compound ID: | M594-0703 |
| Compound Name: | 2-fluoro-N-{[2-(3-methylphenyl)pyridin-3-yl]methyl}benzamide |
| Molecular Weight: | 320.36 |
| Molecular Formula: | C20 H17 F N2 O |
| Smiles: | [H]c1cc([H])nc(c2cccc(C)c2)c1CNC(c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1506 |
| logD: | 4.1489 |
| logSw: | -4.2443 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.199 |
| InChI Key: | FKGHRLJONWRVLD-UHFFFAOYSA-N |