[4-(3-methylphenyl)piperazin-1-yl][3-(3-propyl-3H-imidazo[4,5-b]pyridin-2-yl)phenyl]methanone
Chemical Structure Depiction of
[4-(3-methylphenyl)piperazin-1-yl][3-(3-propyl-3H-imidazo[4,5-b]pyridin-2-yl)phenyl]methanone
[4-(3-methylphenyl)piperazin-1-yl][3-(3-propyl-3H-imidazo[4,5-b]pyridin-2-yl)phenyl]methanone
Compound characteristics
| Compound ID: | M621-1067 |
| Compound Name: | [4-(3-methylphenyl)piperazin-1-yl][3-(3-propyl-3H-imidazo[4,5-b]pyridin-2-yl)phenyl]methanone |
| Molecular Weight: | 439.56 |
| Molecular Formula: | C27 H29 N5 O |
| Smiles: | CCCn1c(c2cccc(c2)C(N2CCN(CC2)c2cccc(C)c2)=O)nc2cccnc12 |
| Stereo: | ACHIRAL |
| logP: | 4.6981 |
| logD: | 4.6979 |
| logSw: | -4.4583 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.961 |
| InChI Key: | ASBIKSMAAKBTBM-UHFFFAOYSA-N |