N-{[6-(azepan-1-yl)pyridin-3-yl]methyl}-4-chloro-2-methoxybenzamide
Chemical Structure Depiction of
N-{[6-(azepan-1-yl)pyridin-3-yl]methyl}-4-chloro-2-methoxybenzamide
N-{[6-(azepan-1-yl)pyridin-3-yl]methyl}-4-chloro-2-methoxybenzamide
Compound characteristics
| Compound ID: | M626-0813 |
| Compound Name: | N-{[6-(azepan-1-yl)pyridin-3-yl]methyl}-4-chloro-2-methoxybenzamide |
| Molecular Weight: | 373.88 |
| Molecular Formula: | C20 H24 Cl N3 O2 |
| Smiles: | COc1cc(ccc1C(NCc1ccc(nc1)N1CCCCCC1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.9642 |
| logD: | 4.955 |
| logSw: | -4.9182 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.667 |
| InChI Key: | AMZWBMZJWVNLLO-UHFFFAOYSA-N |