5-fluoro-3-methoxy-N-[1-(thiophen-2-yl)propyl]-1-benzothiophene-2-carboxamide
Chemical Structure Depiction of
5-fluoro-3-methoxy-N-[1-(thiophen-2-yl)propyl]-1-benzothiophene-2-carboxamide
5-fluoro-3-methoxy-N-[1-(thiophen-2-yl)propyl]-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | M648-0881 |
| Compound Name: | 5-fluoro-3-methoxy-N-[1-(thiophen-2-yl)propyl]-1-benzothiophene-2-carboxamide |
| Molecular Weight: | 349.44 |
| Molecular Formula: | C17 H16 F N O2 S2 |
| Smiles: | CCC(c1cccs1)NC(c1c(c2cc(ccc2s1)F)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3708 |
| logD: | 4.3708 |
| logSw: | -4.3157 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.764 |
| InChI Key: | CCFCFZIWWPZBBW-LBPRGKRZSA-N |