(5-chloro-3-methoxy-1-benzothiophen-2-yl)[4-(4-methoxyphenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
(5-chloro-3-methoxy-1-benzothiophen-2-yl)[4-(4-methoxyphenyl)piperazin-1-yl]methanone
(5-chloro-3-methoxy-1-benzothiophen-2-yl)[4-(4-methoxyphenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | M648-1243 |
| Compound Name: | (5-chloro-3-methoxy-1-benzothiophen-2-yl)[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 416.93 |
| Molecular Formula: | C21 H21 Cl N2 O3 S |
| Smiles: | COc1ccc(cc1)N1CCN(CC1)C(c1c(c2cc(ccc2s1)[Cl])OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8377 |
| logD: | 4.8377 |
| logSw: | -4.8729 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.155 |
| InChI Key: | ILRCNNZDANALFG-UHFFFAOYSA-N |