5-chloro-N-(3-fluoro-4-methoxyphenyl)-3-methoxy-1-benzothiophene-2-carboxamide
					Chemical Structure Depiction of
5-chloro-N-(3-fluoro-4-methoxyphenyl)-3-methoxy-1-benzothiophene-2-carboxamide
			5-chloro-N-(3-fluoro-4-methoxyphenyl)-3-methoxy-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | M648-1275 | 
| Compound Name: | 5-chloro-N-(3-fluoro-4-methoxyphenyl)-3-methoxy-1-benzothiophene-2-carboxamide | 
| Molecular Weight: | 365.81 | 
| Molecular Formula: | C17 H13 Cl F N O3 S | 
| Smiles: | COc1ccc(cc1F)NC(c1c(c2cc(ccc2s1)[Cl])OC)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.6809 | 
| logD: | 4.642 | 
| logSw: | -4.8258 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 39.424 | 
| InChI Key: | QPBFHECOXFKXIL-UHFFFAOYSA-N | 
 
				 
				