N-benzyl-5-chloro-3-methoxy-1-benzothiophene-2-carboxamide
Chemical Structure Depiction of
N-benzyl-5-chloro-3-methoxy-1-benzothiophene-2-carboxamide
N-benzyl-5-chloro-3-methoxy-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | M648-1301 |
| Compound Name: | N-benzyl-5-chloro-3-methoxy-1-benzothiophene-2-carboxamide |
| Molecular Weight: | 331.82 |
| Molecular Formula: | C17 H14 Cl N O2 S |
| Smiles: | COc1c2cc(ccc2sc1C(NCc1ccccc1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.3873 |
| logD: | 4.3872 |
| logSw: | -4.5541 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.116 |
| InChI Key: | KPLSRCNVUSIVSI-UHFFFAOYSA-N |