N-({2-[1-(furan-3-carbonyl)piperidin-3-yl]-1,3-thiazol-4-yl}methyl)acetamide
Chemical Structure Depiction of
N-({2-[1-(furan-3-carbonyl)piperidin-3-yl]-1,3-thiazol-4-yl}methyl)acetamide
N-({2-[1-(furan-3-carbonyl)piperidin-3-yl]-1,3-thiazol-4-yl}methyl)acetamide
Compound characteristics
| Compound ID: | M676-0013 |
| Compound Name: | N-({2-[1-(furan-3-carbonyl)piperidin-3-yl]-1,3-thiazol-4-yl}methyl)acetamide |
| Molecular Weight: | 333.41 |
| Molecular Formula: | C16 H19 N3 O3 S |
| Smiles: | CC(NCc1csc(C2CCCN(C2)C(c2ccoc2)=O)n1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.7686 |
| logD: | 0.7686 |
| logSw: | -1.9111 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.437 |
| InChI Key: | MYXKIMNIDDWCAX-LBPRGKRZSA-N |