N-benzyl-N-ethyl-6-(thiophen-2-yl)pyridine-3-carboxamide
Chemical Structure Depiction of
N-benzyl-N-ethyl-6-(thiophen-2-yl)pyridine-3-carboxamide
N-benzyl-N-ethyl-6-(thiophen-2-yl)pyridine-3-carboxamide
Compound characteristics
| Compound ID: | M710-0995 |
| Compound Name: | N-benzyl-N-ethyl-6-(thiophen-2-yl)pyridine-3-carboxamide |
| Molecular Weight: | 322.43 |
| Molecular Formula: | C19 H18 N2 O S |
| Smiles: | CCN(Cc1ccccc1)C(c1ccc(c2cccs2)nc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7471 |
| logD: | 3.7471 |
| logSw: | -3.8004 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.0584 |
| InChI Key: | NXBYWKNKJLTPHY-UHFFFAOYSA-N |