N-(3-ethyl[1,2,4]triazolo[4,3-a]pyridin-6-yl)-N'-phenylurea
Chemical Structure Depiction of
N-(3-ethyl[1,2,4]triazolo[4,3-a]pyridin-6-yl)-N'-phenylurea
N-(3-ethyl[1,2,4]triazolo[4,3-a]pyridin-6-yl)-N'-phenylurea
Compound characteristics
| Compound ID: | M726-1035 |
| Compound Name: | N-(3-ethyl[1,2,4]triazolo[4,3-a]pyridin-6-yl)-N'-phenylurea |
| Molecular Weight: | 281.31 |
| Molecular Formula: | C15 H15 N5 O |
| Smiles: | CCc1nnc2ccc(cn12)NC(Nc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5364 |
| logD: | 2.5364 |
| logSw: | -2.7926 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.021 |
| InChI Key: | PMAOVVRMLJULGY-UHFFFAOYSA-N |