3-methyl-1-(4-{[2-(morpholine-4-carbonyl)phenoxy]methyl}piperidin-1-yl)butan-1-one
Chemical Structure Depiction of
3-methyl-1-(4-{[2-(morpholine-4-carbonyl)phenoxy]methyl}piperidin-1-yl)butan-1-one
3-methyl-1-(4-{[2-(morpholine-4-carbonyl)phenoxy]methyl}piperidin-1-yl)butan-1-one
Compound characteristics
| Compound ID: | M734-0337 |
| Compound Name: | 3-methyl-1-(4-{[2-(morpholine-4-carbonyl)phenoxy]methyl}piperidin-1-yl)butan-1-one |
| Molecular Weight: | 388.51 |
| Molecular Formula: | C22 H32 N2 O4 |
| Smiles: | CC(C)CC(N1CCC(CC1)COc1ccccc1C(N1CCOCC1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6926 |
| logD: | 2.6926 |
| logSw: | -3.3305 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.502 |
| InChI Key: | ZIFDPGMMMVKFDM-UHFFFAOYSA-N |