(2-{[1-(1,4-dioxaspiro[4.5]decan-8-yl)piperidin-3-yl]methoxy}phenyl)(morpholin-4-yl)methanone
Chemical Structure Depiction of
(2-{[1-(1,4-dioxaspiro[4.5]decan-8-yl)piperidin-3-yl]methoxy}phenyl)(morpholin-4-yl)methanone
(2-{[1-(1,4-dioxaspiro[4.5]decan-8-yl)piperidin-3-yl]methoxy}phenyl)(morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | M735-1454 |
| Compound Name: | (2-{[1-(1,4-dioxaspiro[4.5]decan-8-yl)piperidin-3-yl]methoxy}phenyl)(morpholin-4-yl)methanone |
| Molecular Weight: | 444.57 |
| Molecular Formula: | C25 H36 N2 O5 |
| Smiles: | C1CC(CN(C1)C1CCC2(CC1)OCCO2)COc1ccccc1C(N1CCOCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4021 |
| logD: | -0.0911 |
| logSw: | -2.7728 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.765 |
| InChI Key: | FSGNNLHVWTWLHR-FQEVSTJZSA-N |