(2-{[1-(1H-indole-5-carbonyl)piperidin-3-yl]methoxy}phenyl)(morpholin-4-yl)methanone
Chemical Structure Depiction of
(2-{[1-(1H-indole-5-carbonyl)piperidin-3-yl]methoxy}phenyl)(morpholin-4-yl)methanone
(2-{[1-(1H-indole-5-carbonyl)piperidin-3-yl]methoxy}phenyl)(morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | M735-1645 |
| Compound Name: | (2-{[1-(1H-indole-5-carbonyl)piperidin-3-yl]methoxy}phenyl)(morpholin-4-yl)methanone |
| Molecular Weight: | 447.53 |
| Molecular Formula: | C26 H29 N3 O4 |
| Smiles: | C1CC(CN(C1)C(c1ccc2c(cc[nH]2)c1)=O)COc1ccccc1C(N1CCOCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6382 |
| logD: | 2.6382 |
| logSw: | -3.2567 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.472 |
| InChI Key: | AVJRTKYGTDCONV-IBGZPJMESA-N |