(4-{[1-(furan-3-carbonyl)piperidin-4-yl]methoxy}phenyl)(morpholin-4-yl)methanone
Chemical Structure Depiction of
(4-{[1-(furan-3-carbonyl)piperidin-4-yl]methoxy}phenyl)(morpholin-4-yl)methanone
(4-{[1-(furan-3-carbonyl)piperidin-4-yl]methoxy}phenyl)(morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | M745-0322 |
| Compound Name: | (4-{[1-(furan-3-carbonyl)piperidin-4-yl]methoxy}phenyl)(morpholin-4-yl)methanone |
| Molecular Weight: | 398.46 |
| Molecular Formula: | C22 H26 N2 O5 |
| Smiles: | C1CN(CCC1COc1ccc(cc1)C(N1CCOCC1)=O)C(c1ccoc1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8236 |
| logD: | 1.8236 |
| logSw: | -2.0006 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 56.474 |
| InChI Key: | UYJJGLDSIQHSKH-UHFFFAOYSA-N |