2-(4-fluorophenyl)-1-[4-(2-phenoxyethyl)piperidin-1-yl]ethan-1-one
Chemical Structure Depiction of
2-(4-fluorophenyl)-1-[4-(2-phenoxyethyl)piperidin-1-yl]ethan-1-one
2-(4-fluorophenyl)-1-[4-(2-phenoxyethyl)piperidin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | M747-1049 |
| Compound Name: | 2-(4-fluorophenyl)-1-[4-(2-phenoxyethyl)piperidin-1-yl]ethan-1-one |
| Molecular Weight: | 341.42 |
| Molecular Formula: | C21 H24 F N O2 |
| Smiles: | C1CN(CCC1CCOc1ccccc1)C(Cc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4017 |
| logD: | 4.4017 |
| logSw: | -4.4011 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.5055 |
| InChI Key: | NJBKLTGMBWCXOU-UHFFFAOYSA-N |