[3-(dimethylamino)phenyl]{4-[2-(3-fluorophenoxy)ethyl]piperidin-1-yl}methanone
Chemical Structure Depiction of
[3-(dimethylamino)phenyl]{4-[2-(3-fluorophenoxy)ethyl]piperidin-1-yl}methanone
[3-(dimethylamino)phenyl]{4-[2-(3-fluorophenoxy)ethyl]piperidin-1-yl}methanone
Compound characteristics
| Compound ID: | M747-1495 |
| Compound Name: | [3-(dimethylamino)phenyl]{4-[2-(3-fluorophenoxy)ethyl]piperidin-1-yl}methanone |
| Molecular Weight: | 370.47 |
| Molecular Formula: | C22 H27 F N2 O2 |
| Smiles: | CN(C)c1cccc(c1)C(N1CCC(CC1)CCOc1cccc(c1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4644 |
| logD: | 4.4644 |
| logSw: | -4.3602 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 26.8376 |
| InChI Key: | ZODKACPSTZJONY-UHFFFAOYSA-N |