(3,4-difluorophenyl){4-[2-(4-fluorophenoxy)ethyl]piperidin-1-yl}methanone
					Chemical Structure Depiction of
(3,4-difluorophenyl){4-[2-(4-fluorophenoxy)ethyl]piperidin-1-yl}methanone
			(3,4-difluorophenyl){4-[2-(4-fluorophenoxy)ethyl]piperidin-1-yl}methanone
Compound characteristics
| Compound ID: | M747-1592 | 
| Compound Name: | (3,4-difluorophenyl){4-[2-(4-fluorophenoxy)ethyl]piperidin-1-yl}methanone | 
| Molecular Weight: | 363.38 | 
| Molecular Formula: | C20 H20 F3 N O2 | 
| Smiles: | C1CN(CCC1CCOc1ccc(cc1)F)C(c1ccc(c(c1)F)F)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.4433 | 
| logD: | 4.4433 | 
| logSw: | -4.4052 | 
| Hydrogen bond acceptors count: | 3 | 
| Polar surface area: | 24.0329 | 
| InChI Key: | MTAAAFWZYZSGCM-UHFFFAOYSA-N | 
 
				 
				