2-phenyl-1-(4-{2-[(pyridin-4-yl)oxy]ethyl}piperidin-1-yl)propan-1-one
Chemical Structure Depiction of
2-phenyl-1-(4-{2-[(pyridin-4-yl)oxy]ethyl}piperidin-1-yl)propan-1-one
2-phenyl-1-(4-{2-[(pyridin-4-yl)oxy]ethyl}piperidin-1-yl)propan-1-one
Compound characteristics
| Compound ID: | M747-3020 |
| Compound Name: | 2-phenyl-1-(4-{2-[(pyridin-4-yl)oxy]ethyl}piperidin-1-yl)propan-1-one |
| Molecular Weight: | 338.45 |
| Molecular Formula: | C21 H26 N2 O2 |
| Smiles: | CC(C(N1CCC(CC1)CCOc1ccncc1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6394 |
| logD: | 3.6392 |
| logSw: | -3.6555 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.461 |
| InChI Key: | ORPWUBDHQUOWGK-QGZVFWFLSA-N |