2-phenoxy-1-(4-{2-[(pyridin-3-yl)oxy]ethyl}piperidin-1-yl)ethan-1-one
Chemical Structure Depiction of
2-phenoxy-1-(4-{2-[(pyridin-3-yl)oxy]ethyl}piperidin-1-yl)ethan-1-one
2-phenoxy-1-(4-{2-[(pyridin-3-yl)oxy]ethyl}piperidin-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | M747-3232 |
| Compound Name: | 2-phenoxy-1-(4-{2-[(pyridin-3-yl)oxy]ethyl}piperidin-1-yl)ethan-1-one |
| Molecular Weight: | 340.42 |
| Molecular Formula: | C20 H24 N2 O3 |
| Smiles: | C1CN(CCC1CCOc1cccnc1)C(COc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6946 |
| logD: | 2.6915 |
| logSw: | -2.4842 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 40.522 |
| InChI Key: | CNZAYCFCVCFJAD-UHFFFAOYSA-N |