(3-{ethyl[(pyridin-4-yl)methyl]amino}azetidin-1-yl)(4-methoxyphenyl)methanone
Chemical Structure Depiction of
(3-{ethyl[(pyridin-4-yl)methyl]amino}azetidin-1-yl)(4-methoxyphenyl)methanone
(3-{ethyl[(pyridin-4-yl)methyl]amino}azetidin-1-yl)(4-methoxyphenyl)methanone
Compound characteristics
| Compound ID: | M758-2784 |
| Compound Name: | (3-{ethyl[(pyridin-4-yl)methyl]amino}azetidin-1-yl)(4-methoxyphenyl)methanone |
| Molecular Weight: | 325.41 |
| Molecular Formula: | C19 H23 N3 O2 |
| Smiles: | CCN(Cc1ccncc1)C1CN(C1)C(c1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 1.3508 |
| logD: | 1.2912 |
| logSw: | -1.6093 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.438 |
| InChI Key: | NAUPGMRNODCKLO-UHFFFAOYSA-N |