N-{2-[5-(5-chloro-1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]ethyl}-3,5-dimethoxy-N-methylbenzamide
Chemical Structure Depiction of
N-{2-[5-(5-chloro-1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]ethyl}-3,5-dimethoxy-N-methylbenzamide
N-{2-[5-(5-chloro-1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]ethyl}-3,5-dimethoxy-N-methylbenzamide
Compound characteristics
| Compound ID: | M769-1402 |
| Compound Name: | N-{2-[5-(5-chloro-1H-indol-2-yl)-1,2,4-oxadiazol-3-yl]ethyl}-3,5-dimethoxy-N-methylbenzamide |
| Molecular Weight: | 440.89 |
| Molecular Formula: | C22 H21 Cl N4 O4 |
| Smiles: | CN(CCc1nc(c2cc3cc(ccc3[nH]2)[Cl])on1)C(c1cc(cc(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3523 |
| logD: | 4.3523 |
| logSw: | -4.5359 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.472 |
| InChI Key: | MCHRKEGUQXEEOC-UHFFFAOYSA-N |