[4-(2-fluorophenyl)piperazin-1-yl][1-(6-phenoxypyrimidin-4-yl)piperidin-4-yl]methanone
Chemical Structure Depiction of
[4-(2-fluorophenyl)piperazin-1-yl][1-(6-phenoxypyrimidin-4-yl)piperidin-4-yl]methanone
[4-(2-fluorophenyl)piperazin-1-yl][1-(6-phenoxypyrimidin-4-yl)piperidin-4-yl]methanone
Compound characteristics
| Compound ID: | M778-0258 |
| Compound Name: | [4-(2-fluorophenyl)piperazin-1-yl][1-(6-phenoxypyrimidin-4-yl)piperidin-4-yl]methanone |
| Molecular Weight: | 461.54 |
| Molecular Formula: | C26 H28 F N5 O2 |
| Smiles: | C1CN(CCC1C(N1CCN(CC1)c1ccccc1F)=O)c1cc(ncn1)Oc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.3073 |
| logD: | 4.3073 |
| logSw: | -4.4344 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.22 |
| InChI Key: | HBCYQJMWAAPHIW-UHFFFAOYSA-N |