1-[6-(2,3-dimethylphenoxy)pyrimidin-4-yl]-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide
Chemical Structure Depiction of
1-[6-(2,3-dimethylphenoxy)pyrimidin-4-yl]-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide
1-[6-(2,3-dimethylphenoxy)pyrimidin-4-yl]-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | M778-1001 |
| Compound Name: | 1-[6-(2,3-dimethylphenoxy)pyrimidin-4-yl]-N-(4-phenylbutan-2-yl)piperidine-4-carboxamide |
| Molecular Weight: | 458.6 |
| Molecular Formula: | C28 H34 N4 O2 |
| Smiles: | CC(CCc1ccccc1)NC(C1CCN(CC1)c1cc(ncn1)Oc1cccc(C)c1C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.7124 |
| logD: | 5.7124 |
| logSw: | -5.4568 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.554 |
| InChI Key: | JASOPFFTEOSJPI-NRFANRHFSA-N |