1-{6-[(2,5-dimethylphenyl)sulfanyl]pyrimidin-4-yl}-N-[(4-ethoxyphenyl)methyl]piperidine-4-carboxamide
Chemical Structure Depiction of
1-{6-[(2,5-dimethylphenyl)sulfanyl]pyrimidin-4-yl}-N-[(4-ethoxyphenyl)methyl]piperidine-4-carboxamide
1-{6-[(2,5-dimethylphenyl)sulfanyl]pyrimidin-4-yl}-N-[(4-ethoxyphenyl)methyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | M779-0608 |
| Compound Name: | 1-{6-[(2,5-dimethylphenyl)sulfanyl]pyrimidin-4-yl}-N-[(4-ethoxyphenyl)methyl]piperidine-4-carboxamide |
| Molecular Weight: | 476.64 |
| Molecular Formula: | C27 H32 N4 O2 S |
| Smiles: | CCOc1ccc(CNC(C2CCN(CC2)c2cc(ncn2)Sc2cc(C)ccc2C)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.779 |
| logD: | 5.7786 |
| logSw: | -5.3445 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.591 |
| InChI Key: | LEPOJPNXABXTJV-UHFFFAOYSA-N |