N-(2-chloro-5-fluorophenyl)-2-ethyl-6-methylimidazo[2,1-b][1,3,4]thiadiazole-5-sulfonamide
Chemical Structure Depiction of
N-(2-chloro-5-fluorophenyl)-2-ethyl-6-methylimidazo[2,1-b][1,3,4]thiadiazole-5-sulfonamide
N-(2-chloro-5-fluorophenyl)-2-ethyl-6-methylimidazo[2,1-b][1,3,4]thiadiazole-5-sulfonamide
Compound characteristics
| Compound ID: | M810-0920 |
| Compound Name: | N-(2-chloro-5-fluorophenyl)-2-ethyl-6-methylimidazo[2,1-b][1,3,4]thiadiazole-5-sulfonamide |
| Molecular Weight: | 374.84 |
| Molecular Formula: | C13 H12 Cl F N4 O2 S2 |
| Smiles: | CCc1nn2c(c(C)nc2s1)S(Nc1cc(ccc1[Cl])F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2224 |
| logD: | 0.9247 |
| logSw: | -3.5072 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.243 |
| InChI Key: | AJXWYWHXRXYHAS-UHFFFAOYSA-N |